CAS 1807539-07-6 appears in our catalog under these names: Benzyl-peg6-ms, 95%, Benzyl–PEG5–Ms, Benzyl-PEG5-ms, Benzyl-PEG5-MS, 97%, 97%, Benzyl-PEG5-MS, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 500mg, 250mg, 1g, 1000mg, 100mg, 25 mg, 100 mg, 250 mg.
2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (CAS 1807539-07-6) is a chemical compound with the molecular formula C18H30O8S and a molecular weight of 406.5 g/mol. IUPAC name: 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate. InChIKey: ILKVVAFIJJSDHU-UHFFFAOYSA-N.
| Molecular formula | C18H30O8S |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| InChIKey | ILKVVAFIJJSDHU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOCCOCCOCCOCC1=CC=CC=C1 |
Computed by PubChem (NCBI)