CAS 1807539-08-7 appears in our catalog under these names: Bis-peg4-sulfonic acid, 95%, Bis-PEG4-sulfonic acid, 98%, Bis-PEG4-sulfonic acid, Bis–PEG4–sulfonic acid, Bis-PEG4-sulfonic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5mg, 500mg, 50 mg, 100 mg, 25 mg.
2-[2-[2-[2-(2-sulfoethoxy)ethoxy]ethoxy]ethoxy]ethanesulfonic acid (CAS 1807539-08-7) is a chemical compound with the molecular formula C10H22O10S2 and a molecular weight of 366.4 g/mol. IUPAC name: 2-[2-[2-[2-(2-sulfoethoxy)ethoxy]ethoxy]ethoxy]ethanesulfonic acid. InChIKey: URCFPXZEPHPAIR-UHFFFAOYSA-N.
| Molecular formula | C10H22O10S2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-sulfoethoxy)ethoxy]ethoxy]ethoxy]ethanesulfonic acid |
| InChIKey | URCFPXZEPHPAIR-UHFFFAOYSA-N |
| SMILES | C(COCCOCCS(=O)(=O)O)OCCOCCS(=O)(=O)O |
Computed by PubChem (NCBI)