CAS 1807542-95-5 appears in our catalog under these names: 1-((4-Bromophenyl)sulfonyl)-2-fluorobenzene, 95%, 2–((4–Bromophenyl)sulfonyl)fluorobenzene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
1-(4-bromophenyl)sulfonyl-2-fluorobenzene (CAS 1807542-95-5) is a chemical compound with the molecular formula C12H8BrFO2S and a molecular weight of 315.16 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-2-fluorobenzene. InChIKey: WJVFKYMLGAXHSU-UHFFFAOYSA-N.
| Molecular formula | C12H8BrFO2S |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-2-fluorobenzene |
| InChIKey | WJVFKYMLGAXHSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)