Products 1807594-11-1
CAS 1807594-11-1 is the registry number for N-(2-bromo-4-isopropylphenyl)-2,2,2-trifluoroacetamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(2-bromo-4-propan-2-ylphenyl)-2,2,2-trifluoroacetamide (CAS 1807594-11-1) is a chemical compound with the molecular formula C11H11BrF3NO and a molecular weight of 310.11 g/mol. IUPAC name: N-(2-bromo-4-propan-2-ylphenyl)-2,2,2-trifluoroacetamide. InChIKey: MSXUVWHFWJYMOG-UHFFFAOYSA-N.
| Molecular formula | C11H11BrF3NO |
|---|---|
| Molecular weight | 310.11 g/mol |
| IUPAC name | N-(2-bromo-4-propan-2-ylphenyl)-2,2,2-trifluoroacetamide |
| InChIKey | MSXUVWHFWJYMOG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)NC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)