CAS 1807608-29-2 is the registry number for Morinidazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(hydroxymethyl)-5-nitroimidazol-1-yl]-3-morpholin-4-ylpropan-2-ol (CAS 1807608-29-2) is a chemical compound with the molecular formula C11H18N4O5 and a molecular weight of 286.28 g/mol. IUPAC name: 1-[2-(hydroxymethyl)-5-nitroimidazol-1-yl]-3-morpholin-4-ylpropan-2-ol. InChIKey: ZCWPIUSKZBCSLO-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 1-[2-(hydroxymethyl)-5-nitroimidazol-1-yl]-3-morpholin-4-ylpropan-2-ol |
| InChIKey | ZCWPIUSKZBCSLO-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC(CN2C(=CN=C2CO)[N+](=O)[O-])O |
Computed by PubChem (NCBI)