CAS 1807646-35-0 is the registry number for 4-Bromo-2,3-difluoro-6-iodo-1-(trimethylsilyl)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4-bromo-2,3-difluoro-6-iodophenyl)-trimethylsilane (CAS 1807646-35-0) is a chemical compound with the molecular formula C9H10BrF2ISi and a molecular weight of 391.07 g/mol. IUPAC name: (4-bromo-2,3-difluoro-6-iodophenyl)-trimethylsilane. InChIKey: ATYKKOFBPWGTQV-UHFFFAOYSA-N.
| Molecular formula | C9H10BrF2ISi |
|---|---|
| Molecular weight | 391.07 g/mol |
| IUPAC name | (4-bromo-2,3-difluoro-6-iodophenyl)-trimethylsilane |
| InChIKey | ATYKKOFBPWGTQV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=C(C(=C1F)F)Br)I |
Computed by PubChem (NCBI)