CAS 1807698-28-7 is the registry number for 2-Amino-4-bromo-6-fluoro-3-nitrobenzonitrile, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-amino-4-bromo-6-fluoro-3-nitrobenzonitrile (CAS 1807698-28-7) is a chemical compound with the molecular formula C7H3BrFN3O2 and a molecular weight of 260.02 g/mol. IUPAC name: 2-amino-4-bromo-6-fluoro-3-nitrobenzonitrile. InChIKey: OTKGQQNKTBBSRD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFN3O2 |
|---|---|
| Molecular weight | 260.02 g/mol |
| IUPAC name | 2-amino-4-bromo-6-fluoro-3-nitrobenzonitrile |
| InChIKey | OTKGQQNKTBBSRD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)[N+](=O)[O-])N)C#N)F |
Computed by PubChem (NCBI)