CAS 1807882-32-1 is the registry number for Rel-(1R,5S)-7,7-dimethyl-2-oxabicyclo(3.2.0)heptan-6-one, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(1S,5R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one (CAS 1807882-32-1) is a chemical compound with the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. IUPAC name: (1S,5R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one. InChIKey: IBUYIUUEKIEMMA-FSPLSTOPSA-N.
| Molecular formula | C8H12O2 |
|---|---|
| Molecular weight | 140.18 g/mol |
| IUPAC name | (1S,5R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-one |
| InChIKey | IBUYIUUEKIEMMA-FSPLSTOPSA-N |
| SMILES | CC1([C@@H]2[C@H](C1=O)CCO2)C |
Computed by PubChem (NCBI)