CAS 1807882-44-5 appears in our catalog under these names: (1S,2S)-N1,N1-Dimethylcyclopentane-1,2-diamine dihydrochloride, 95%, (1S,2S)-N1,N1-Dimethylcyclopentane-1,2-diamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Trans-(1S,2S)-1-N,1-N-dimethylcyclopentane-1,2-diamine;dihydrochloride (CAS 1807882-44-5) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: trans-(1S,2S)-1-N,1-N-dimethylcyclopentane-1,2-diamine;dihydrochloride. InChIKey: KARKSOALPPLYBK-JFYKYWLVSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | trans-(1S,2S)-1-N,1-N-dimethylcyclopentane-1,2-diamine;dihydrochloride |
| InChIKey | KARKSOALPPLYBK-JFYKYWLVSA-N |
| SMILES | CN(C)[C@H]1CCC[C@@H]1N.Cl.Cl |
Computed by PubChem (NCBI)