CAS 1807901-38-7 is the registry number for (5S)-5-(4-fluorophenyl)-5-hydroxypentanoate lithium (I). Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium (5S)-5-(4-fluorophenyl)-5-hydroxypentanoate (CAS 1807901-38-7) is a chemical compound with the molecular formula C11H12FLiO3 and a molecular weight of 218.2 g/mol. IUPAC name: lithium (5S)-5-(4-fluorophenyl)-5-hydroxypentanoate. InChIKey: FIJMGIHSUXBTOU-PPHPATTJSA-M.
| Molecular formula | C11H12FLiO3 |
|---|---|
| Molecular weight | 218.2 g/mol |
| IUPAC name | lithium (5S)-5-(4-fluorophenyl)-5-hydroxypentanoate |
| InChIKey | FIJMGIHSUXBTOU-PPHPATTJSA-M |
| SMILES | [Li+].C1=CC(=CC=C1[C@H](CCCC(=O)[O-])O)F |
Computed by PubChem (NCBI)