CAS 1807901-57-0 appears in our catalog under these names: (1R,5S,6R)-6-(Methoxymethyl)-3-azabicyclo(3.1.0)hexane hydrochloride, (1R,5S,6r)-6-(Methoxymethyl)-3-azabicyclo[3.1.0]hexane hydrochloride, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(1R,5S)-6-(methoxymethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 1807901-57-0) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (1R,5S)-6-(methoxymethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: IVRGNCGRYDPORC-VPEOJXMDSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (1R,5S)-6-(methoxymethyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | IVRGNCGRYDPORC-VPEOJXMDSA-N |
| SMILES | COCC1[C@H]2[C@@H]1CNC2.Cl |
Computed by PubChem (NCBI)