CAS 1807921-05-6 appears in our catalog under these names: (1R)-1-(5-Methyl-1,2-oxazol-3-yl)ethan-1-amine hydrochloride, 95%, (1R)-1-(5-Methyl-1,2-oxazol-3-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethanamine;hydrochloride (CAS 1807921-05-6) is a chemical compound with the molecular formula C6H11ClN2O and a molecular weight of 162.62 g/mol. IUPAC name: (1R)-1-(5-methyl-1,2-oxazol-3-yl)ethanamine;hydrochloride. InChIKey: QBMTWUGXENYRJQ-NUBCRITNSA-N.
| Molecular formula | C6H11ClN2O |
|---|---|
| Molecular weight | 162.62 g/mol |
| IUPAC name | (1R)-1-(5-methyl-1,2-oxazol-3-yl)ethanamine;hydrochloride |
| InChIKey | QBMTWUGXENYRJQ-NUBCRITNSA-N |
| SMILES | CC1=CC(=NO1)[C@@H](C)N.Cl |
Computed by PubChem (NCBI)