CAS 1807921-11-4 appears in our catalog under these names: (3R)-3-Amino-N,N-dimethylpiperidine-1-sulfonamide hydrochloride, 95%, (3R)-3-Amino-N,N-dimethylpiperidine-1-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride (CAS 1807921-11-4) is a chemical compound with the molecular formula C7H18ClN3O2S and a molecular weight of 243.76 g/mol. IUPAC name: (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride. InChIKey: CGTIRAPEJOPAQL-OGFXRTJISA-N.
| Molecular formula | C7H18ClN3O2S |
|---|---|
| Molecular weight | 243.76 g/mol |
| IUPAC name | (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride |
| InChIKey | CGTIRAPEJOPAQL-OGFXRTJISA-N |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)