CAS 1807937-28-5 is the registry number for rel-(2R,4R)-2-Methylpiperidine-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R)-2-methylpiperidine-4-carboxylic acid (CAS 1807937-28-5) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: (2R,4R)-2-methylpiperidine-4-carboxylic acid. InChIKey: OSHLFUFMLXAGMN-PHDIDXHHSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | (2R,4R)-2-methylpiperidine-4-carboxylic acid |
| InChIKey | OSHLFUFMLXAGMN-PHDIDXHHSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)C(=O)O |
Computed by PubChem (NCBI)