CAS 1807937-55-8 appears in our catalog under these names: Cis-5-methyloxolane-2-carboxylic acid, 95%, Cis-5-methyltetrahydrofuran-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
(2R,5R)-5-methyloxolane-2-carboxylic acid (CAS 1807937-55-8) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: (2R,5R)-5-methyloxolane-2-carboxylic acid. InChIKey: NWEBMMMSMHXMLR-RFZPGFLSSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | (2R,5R)-5-methyloxolane-2-carboxylic acid |
| InChIKey | NWEBMMMSMHXMLR-RFZPGFLSSA-N |
| SMILES | C[C@@H]1CC[C@@H](O1)C(=O)O |
Computed by PubChem (NCBI)