CAS 1807937-63-8 appears in our catalog under these names: (1S)-1-(1H-Imidazol-2-yl)ethan-1-amine dihydrochloride, (1S)-1-(1H-imidazol-2-yl)ethan-1-amine dihydrochloride, 95%, 95%, (S)-1-(1H-Imidazol-2-yl)ethan-1-amine dihydrochloride, ¡Ã97.0%, (S)-1-(1H-Imidazol-2-yl)ethan-1-amine dihydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
(1S)-1-(1H-imidazol-2-yl)ethanamine;dihydrochloride (CAS 1807937-63-8) is a chemical compound with the molecular formula C5H11Cl2N3 and a molecular weight of 184.06 g/mol. IUPAC name: (1S)-1-(1H-imidazol-2-yl)ethanamine;dihydrochloride. InChIKey: XIWLRTUEVSNHJT-FHNDMYTFSA-N.
| Molecular formula | C5H11Cl2N3 |
|---|---|
| Molecular weight | 184.06 g/mol |
| IUPAC name | (1S)-1-(1H-imidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | XIWLRTUEVSNHJT-FHNDMYTFSA-N |
| SMILES | C[C@@H](C1=NC=CN1)N.Cl.Cl |
Computed by PubChem (NCBI)