Products 1807937-65-0
CAS 1807937-65-0 is the registry number for (2R)-1-{(1-(4-Chlorophenyl)propan-2-yl)amino}propan-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(2R)-1-[1-(4-chlorophenyl)propan-2-ylamino]propan-2-ol;hydrochloride (CAS 1807937-65-0) is a chemical compound with the molecular formula C12H19Cl2NO and a molecular weight of 264.19 g/mol. IUPAC name: (2R)-1-[1-(4-chlorophenyl)propan-2-ylamino]propan-2-ol;hydrochloride. InChIKey: HVKADNLRUWKITK-FJYJDOHQSA-N.
| Molecular formula | C12H19Cl2NO |
|---|---|
| Molecular weight | 264.19 g/mol |
| IUPAC name | (2R)-1-[1-(4-chlorophenyl)propan-2-ylamino]propan-2-ol;hydrochloride |
| InChIKey | HVKADNLRUWKITK-FJYJDOHQSA-N |
| SMILES | C[C@H](CNC(C)CC1=CC=C(C=C1)Cl)O.Cl |
Computed by PubChem (NCBI)