CAS 1807938-00-6 is the registry number for N-(6-Phenyl-2,3-dihydro-1H-inden-1-ylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(NZ)-N-(6-phenyl-2,3-dihydroinden-1-ylidene)hydroxylamine (CAS 1807938-00-6) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: (NZ)-N-(6-phenyl-2,3-dihydroinden-1-ylidene)hydroxylamine. InChIKey: BKQSTNQPVSGLIM-NXVVXOECSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (NZ)-N-(6-phenyl-2,3-dihydroinden-1-ylidene)hydroxylamine |
| InChIKey | BKQSTNQPVSGLIM-NXVVXOECSA-N |
| SMILES | C1C/C(=N/O)/C2=C1C=CC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)