CAS 1807938-32-4 appears in our catalog under these names: Ethyl 2,4,4-trimethylpent-2-enoate, 95%, Ethyl 2,4,4-trimethylpent-2-enoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Ethyl (E)-2,4,4-trimethylpent-2-enoate (CAS 1807938-32-4) is a chemical compound with the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. IUPAC name: ethyl (E)-2,4,4-trimethylpent-2-enoate. InChIKey: FJSPLBAXDGTACK-BQYQJAHWSA-N.
| Molecular formula | C10H18O2 |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | ethyl (E)-2,4,4-trimethylpent-2-enoate |
| InChIKey | FJSPLBAXDGTACK-BQYQJAHWSA-N |
| SMILES | CCOC(=O)/C(=C/C(C)(C)C)/C |
Computed by PubChem (NCBI)