CAS 1807938-52-8 is the registry number for (1S)-1-(1,3-Thiazol-5-yl)ethan-1-amine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-1-(1,3-thiazol-5-yl)ethanamine;dihydrochloride (CAS 1807938-52-8) is a chemical compound with the molecular formula C5H10Cl2N2S and a molecular weight of 201.12 g/mol. IUPAC name: (1S)-1-(1,3-thiazol-5-yl)ethanamine;dihydrochloride. InChIKey: MGBRARVJRDYNOI-FHNDMYTFSA-N.
| Molecular formula | C5H10Cl2N2S |
|---|---|
| Molecular weight | 201.12 g/mol |
| IUPAC name | (1S)-1-(1,3-thiazol-5-yl)ethanamine;dihydrochloride |
| InChIKey | MGBRARVJRDYNOI-FHNDMYTFSA-N |
| SMILES | C[C@@H](C1=CN=CS1)N.Cl.Cl |
Computed by PubChem (NCBI)