Products 1807938-63-1
CAS 1807938-63-1 is the registry number for 1-((3R)-3-Aminopiperidin-1-yl)-4,4,4-trifluorobutan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one;hydrochloride (CAS 1807938-63-1) is a chemical compound with the molecular formula C9H16ClF3N2O and a molecular weight of 260.68 g/mol. IUPAC name: 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one;hydrochloride. InChIKey: UAVWCHITCWBYQI-OGFXRTJISA-N.
| Molecular formula | C9H16ClF3N2O |
|---|---|
| Molecular weight | 260.68 g/mol |
| IUPAC name | 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one;hydrochloride |
| InChIKey | UAVWCHITCWBYQI-OGFXRTJISA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)CCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)