CAS 1807939-24-7 is the registry number for (6R)-6-(Azidomethyl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6R)-6-(azidomethyl)piperidin-2-one (CAS 1807939-24-7) is a chemical compound with the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. IUPAC name: (6R)-6-(azidomethyl)piperidin-2-one. InChIKey: WVBBLZNWGDFLRY-RXMQYKEDSA-N.
| Molecular formula | C6H10N4O |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | (6R)-6-(azidomethyl)piperidin-2-one |
| InChIKey | WVBBLZNWGDFLRY-RXMQYKEDSA-N |
| SMILES | C1C[C@@H](NC(=O)C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)