CAS 1807941-04-3 is the registry number for rel-(2R,3S)-tert-Butyl 3-hydroxy-2-methylpyrrolidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate (CAS 1807941-04-3) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate. InChIKey: RLHMCXQTIPFLRQ-SFYZADRCSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
| InChIKey | RLHMCXQTIPFLRQ-SFYZADRCSA-N |
| SMILES | C[C@@H]1[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)