CAS 1807941-59-8 appears in our catalog under these names: Rel-tert-butyl (2R,4R)-4-(hydroxymethyl)-2-methylpiperidine-1-carboxylate, 98%, rac-tert-Butyl (2R,4R)-4-(hydroxymethyl)-2-methylpiperidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
Tert-butyl (2R,4R)-4-(hydroxymethyl)-2-methylpiperidine-1-carboxylate (CAS 1807941-59-8) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (2R,4R)-4-(hydroxymethyl)-2-methylpiperidine-1-carboxylate. InChIKey: LXOVPEAYTWFSBI-NXEZZACHSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (2R,4R)-4-(hydroxymethyl)-2-methylpiperidine-1-carboxylate |
| InChIKey | LXOVPEAYTWFSBI-NXEZZACHSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)