CAS 1807988-24-4 is the registry number for Methyl 3-chloro-1-(methoxymethyl)-1h-1,2,4-triazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 5-chloro-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate (CAS 1807988-24-4) is a chemical compound with the molecular formula C6H8ClN3O3 and a molecular weight of 205.60 g/mol. IUPAC name: methyl 5-chloro-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate. InChIKey: TVOACMOAMPTNCC-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O3 |
|---|---|
| Molecular weight | 205.60 g/mol |
| IUPAC name | methyl 5-chloro-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate |
| InChIKey | TVOACMOAMPTNCC-UHFFFAOYSA-N |
| SMILES | COCN1C(=NC(=N1)Cl)C(=O)OC |
Computed by PubChem (NCBI)