Products 1807988-24-4

CAS 1807988-24-4 is the registry number for Methyl 3-chloro-1-(methoxymethyl)-1h-1,2,4-triazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-chloro-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate (CAS 1807988-24-4) is a chemical compound with the molecular formula C6H8ClN3O3 and a molecular weight of 205.60 g/mol. IUPAC name: methyl 5-chloro-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate. InChIKey: TVOACMOAMPTNCC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClN3O3
Molecular weight205.60 g/mol
IUPAC namemethyl 5-chloro-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate
InChIKeyTVOACMOAMPTNCC-UHFFFAOYSA-N
SMILESCOCN1C(=NC(=N1)Cl)C(=O)OC

Computed by PubChem (NCBI)