CAS 1808068-96-3 is the registry number for ((2R,5R)-5-Phenyltetrahydrofuran-2-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,5R)-5-phenyloxolan-2-yl]methanamine (CAS 1808068-96-3) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: [(2R,5R)-5-phenyloxolan-2-yl]methanamine. InChIKey: IAIACGGIZWXQIK-GHMZBOCLSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | [(2R,5R)-5-phenyloxolan-2-yl]methanamine |
| InChIKey | IAIACGGIZWXQIK-GHMZBOCLSA-N |
| SMILES | C1C[C@@H](O[C@H]1CN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)