CAS 1808089-07-7 is the registry number for 2-Iodo-1-methoxy-4-((trifluoromethyl)thio)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
2-iodo-1-methoxy-4-(trifluoromethylsulfanyl)benzene (CAS 1808089-07-7) is a chemical compound with the molecular formula C8H6F3IOS and a molecular weight of 334.10 g/mol. IUPAC name: 2-iodo-1-methoxy-4-(trifluoromethylsulfanyl)benzene. InChIKey: BOEGDKGBHNOSLV-UHFFFAOYSA-N.
| Molecular formula | C8H6F3IOS |
|---|---|
| Molecular weight | 334.10 g/mol |
| IUPAC name | 2-iodo-1-methoxy-4-(trifluoromethylsulfanyl)benzene |
| InChIKey | BOEGDKGBHNOSLV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)SC(F)(F)F)I |
Computed by PubChem (NCBI)