CAS 18081-08-8 is the registry number for 2-((Trimethylsilyl)oxy)naphthalene. Offered by: TRC. Available pack sizes: 2,5g.
Trimethyl(naphthalen-2-yloxy)silane (CAS 18081-08-8) is a chemical compound with the molecular formula C13H16OSi and a molecular weight of 216.35 g/mol. IUPAC name: trimethyl(naphthalen-2-yloxy)silane. InChIKey: HJWDNWKQENUSKL-UHFFFAOYSA-N.
| Molecular formula | C13H16OSi |
|---|---|
| Molecular weight | 216.35 g/mol |
| IUPAC name | trimethyl(naphthalen-2-yloxy)silane |
| InChIKey | HJWDNWKQENUSKL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)