CAS 1808106-94-6 appears in our catalog under these names: 1-Boc-4-(6-aminopyridin-3-yl)piperazine-d4, tert-Butyl 4-(6-aminopyridin-3-yl)piperazine-1-carboxylate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 5 mg, 50 mg, 10 mg, 25 mg, 100 mg.
(2S)-2-methylsulfonyloxypropanoic acid (CAS 1808106-94-6) is a chemical compound with the molecular formula C4H8O5S and a molecular weight of 168.17 g/mol. IUPAC name: (2S)-2-methylsulfonyloxypropanoic acid. InChIKey: LFMBKSRGQHUJKP-VKHMYHEASA-N.
| Molecular formula | C4H8O5S |
|---|---|
| Molecular weight | 168.17 g/mol |
| IUPAC name | (2S)-2-methylsulfonyloxypropanoic acid |
| InChIKey | LFMBKSRGQHUJKP-VKHMYHEASA-N |
| SMILES | C[C@@H](C(=O)O)OS(=O)(=O)C |
Computed by PubChem (NCBI)