Products 1808112-57-3

CAS 1808112-57-3 is the registry number for Bizine di(hydrochloride), 99.90%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 100 mg, 5 mg, 10 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

N-[4-(2-hydrazinylethyl)phenyl]-4-phenylbutanamide;dihydrochloride (CAS 1808112-57-3) is a chemical compound with the molecular formula C18H25Cl2N3O and a molecular weight of 370.3 g/mol. IUPAC name: N-[4-(2-hydrazinylethyl)phenyl]-4-phenylbutanamide;dihydrochloride. InChIKey: MUAMIWJQSFQIGT-UHFFFAOYSA-N.

Identity
Molecular formulaC18H25Cl2N3O
Molecular weight370.3 g/mol
IUPAC nameN-[4-(2-hydrazinylethyl)phenyl]-4-phenylbutanamide;dihydrochloride
InChIKeyMUAMIWJQSFQIGT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCCC(=O)NC2=CC=C(C=C2)CCNN.Cl.Cl

Computed by PubChem (NCBI)