CAS 1808266-58-1 appears in our catalog under these names: Alpha–Lipoic Acid Choline Ester, Alpha-lipoic acid choline ester, Arlipoic Acid Choline Ester Chloride 98%, (R)-2-((5-(1,2-Dithiolan-3-yl)pentanoyl)oxy)-N,N,N-trimethylethan-1-aminium chloride, 98%, 98%, Alpha-lipoic acid choline ester (chloride), 99.72%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 1g, 200mg, 2g, 50mg, 500mg, 5g.
2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium chloride (CAS 1808266-58-1) is a chemical compound with the molecular formula C13H26ClNO2S2 and a molecular weight of 327.9 g/mol. IUPAC name: 2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium chloride. InChIKey: QMADNKDMPGZUKN-UTONKHPSSA-M.
| Molecular formula | C13H26ClNO2S2 |
|---|---|
| Molecular weight | 327.9 g/mol |
| IUPAC name | 2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium chloride |
| InChIKey | QMADNKDMPGZUKN-UTONKHPSSA-M |
| SMILES | C[N+](C)(C)CCOC(=O)CCCC[C@@H]1CCSS1.[Cl-] |
Computed by PubChem (NCBI)