CAS 1808313-98-5 is the registry number for (2R,3S)-2-(1,5-Dimethyl-1H-pyrazol-4-yl)tetrahydrofuran-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)oxolan-3-amine (CAS 1808313-98-5) is a chemical compound with the molecular formula C9H15N3O and a molecular weight of 181.23 g/mol. IUPAC name: (2R,3S)-2-(1,5-dimethylpyrazol-4-yl)oxolan-3-amine. InChIKey: IMEFHYRQGSBUQA-DTWKUNHWSA-N.
| Molecular formula | C9H15N3O |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (2R,3S)-2-(1,5-dimethylpyrazol-4-yl)oxolan-3-amine |
| InChIKey | IMEFHYRQGSBUQA-DTWKUNHWSA-N |
| SMILES | CC1=C(C=NN1C)[C@@H]2[C@H](CCO2)N |
Computed by PubChem (NCBI)