CAS 18084-26-9 is the registry number for 3-Bromoalizarin, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-bromo-1,2-dihydroxyanthracene-9,10-dione (CAS 18084-26-9) is a chemical compound with the molecular formula C14H7BrO4 and a molecular weight of 319.11 g/mol. IUPAC name: 3-bromo-1,2-dihydroxyanthracene-9,10-dione. InChIKey: IDRQPAORHHFOCW-UHFFFAOYSA-N.
| Molecular formula | C14H7BrO4 |
|---|---|
| Molecular weight | 319.11 g/mol |
| IUPAC name | 3-bromo-1,2-dihydroxyanthracene-9,10-dione |
| InChIKey | IDRQPAORHHFOCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)Br |
Computed by PubChem (NCBI)