CAS 1808408-97-0 appears in our catalog under these names: Ethyl 2-(5-amino-3,3-difluoro-2-oxo-2,3-dihydro-1H-indol-1-yl)acetate, 95%, Ethyl 2-(5-amino-3,3-difluoro-2-oxo-2,3-dihydro-1H-indol-1-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 2-(5-amino-3,3-difluoro-2-oxoindol-1-yl)acetate (CAS 1808408-97-0) is a chemical compound with the molecular formula C12H12F2N2O3 and a molecular weight of 270.23 g/mol. IUPAC name: ethyl 2-(5-amino-3,3-difluoro-2-oxoindol-1-yl)acetate. InChIKey: AVBMFXQSIUHVKT-UHFFFAOYSA-N.
| Molecular formula | C12H12F2N2O3 |
|---|---|
| Molecular weight | 270.23 g/mol |
| IUPAC name | ethyl 2-(5-amino-3,3-difluoro-2-oxoindol-1-yl)acetate |
| InChIKey | AVBMFXQSIUHVKT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C2=C(C=C(C=C2)N)C(C1=O)(F)F |
Computed by PubChem (NCBI)