CAS 1808535-99-0 is the registry number for ((2R,3S)-2-(1-Methyl-1H-pyrazol-5-yl)tetrahydrofuran-3-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methanamine (CAS 1808535-99-0) is a chemical compound with the molecular formula C9H15N3O and a molecular weight of 181.23 g/mol. IUPAC name: [(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methanamine. InChIKey: RFHQJLOTULCXTL-IONNQARKSA-N.
| Molecular formula | C9H15N3O |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | [(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methanamine |
| InChIKey | RFHQJLOTULCXTL-IONNQARKSA-N |
| SMILES | CN1C(=CC=N1)[C@H]2[C@@H](CCO2)CN |
Computed by PubChem (NCBI)