CAS 1808959-39-8 appears in our catalog under these names: Bis(3-carboxyphenyl)(3-trifluoromethylphenyl)phosphine, 97%, 3,3'-((3-(Trifluoromethyl)phenyl)phosphanediyl)dibenzoic acid, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, 1g.
3-[(3-carboxyphenyl)-[3-(trifluoromethyl)phenyl]phosphanyl]benzoic acid (CAS 1808959-39-8) is a chemical compound with the molecular formula C21H14F3O4P and a molecular weight of 418.3 g/mol. IUPAC name: 3-[(3-carboxyphenyl)-[3-(trifluoromethyl)phenyl]phosphanyl]benzoic acid. InChIKey: GBOUANGEPPDUQX-UHFFFAOYSA-N.
| Molecular formula | C21H14F3O4P |
|---|---|
| Molecular weight | 418.3 g/mol |
| IUPAC name | 3-[(3-carboxyphenyl)-[3-(trifluoromethyl)phenyl]phosphanyl]benzoic acid |
| InChIKey | GBOUANGEPPDUQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)P(C2=CC=CC(=C2)C(=O)O)C3=CC=CC(=C3)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)