Products 1809158-05-1

CAS 1809158-05-1 is the registry number for 4-(4-Bromophenyl)-4-hydroxy-1,1-dimethylcyclohexane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(4-bromophenyl)-4,4-dimethylcyclohexan-1-ol (CAS 1809158-05-1) is a chemical compound with the molecular formula C14H19BrO and a molecular weight of 283.20 g/mol. IUPAC name: 1-(4-bromophenyl)-4,4-dimethylcyclohexan-1-ol. InChIKey: VTHRNWDFOOCUMC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19BrO
Molecular weight283.20 g/mol
IUPAC name1-(4-bromophenyl)-4,4-dimethylcyclohexan-1-ol
InChIKeyVTHRNWDFOOCUMC-UHFFFAOYSA-N
SMILESCC1(CCC(CC1)(C2=CC=C(C=C2)Br)O)C

Computed by PubChem (NCBI)