CAS 1809161-44-1 appears in our catalog under these names: 1-Benzyl-7-fluoro-3-(4-bromophenyl)-1h-indazole, 95%, 1-Benzyl-7-fluoro-3-(4-bromophenyl)-1H-indazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-benzyl-3-(4-bromophenyl)-7-fluoroindazole (CAS 1809161-44-1) is a chemical compound with the molecular formula C20H14BrFN2 and a molecular weight of 381.2 g/mol. IUPAC name: 1-benzyl-3-(4-bromophenyl)-7-fluoroindazole. InChIKey: SLXORLYGKHZZTQ-UHFFFAOYSA-N.
| Molecular formula | C20H14BrFN2 |
|---|---|
| Molecular weight | 381.2 g/mol |
| IUPAC name | 1-benzyl-3-(4-bromophenyl)-7-fluoroindazole |
| InChIKey | SLXORLYGKHZZTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=CC=C3F)C(=N2)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)