CAS 1809161-56-5 is the registry number for 2-Chloro-3-methylthio-6-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
2-chloro-3-methylsulfanyl-6-(trifluoromethyl)pyridine (CAS 1809161-56-5) is a chemical compound with the molecular formula C7H5ClF3NS and a molecular weight of 227.64 g/mol. IUPAC name: 2-chloro-3-methylsulfanyl-6-(trifluoromethyl)pyridine. InChIKey: FOKBCPMVRKOJIH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NS |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | 2-chloro-3-methylsulfanyl-6-(trifluoromethyl)pyridine |
| InChIKey | FOKBCPMVRKOJIH-UHFFFAOYSA-N |
| SMILES | CSC1=C(N=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)