Products 1809168-71-5
CAS 1809168-71-5 is the registry number for 7-Fluoro-3-(3-bromophenyl)-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
3-(3-bromophenyl)-7-fluoro-2H-indazole (CAS 1809168-71-5) is a chemical compound with the molecular formula C13H8BrFN2 and a molecular weight of 291.12 g/mol. IUPAC name: 3-(3-bromophenyl)-7-fluoro-2H-indazole. InChIKey: WXOMCRNSXYXWLG-UHFFFAOYSA-N.
| Molecular formula | C13H8BrFN2 |
|---|---|
| Molecular weight | 291.12 g/mol |
| IUPAC name | 3-(3-bromophenyl)-7-fluoro-2H-indazole |
| InChIKey | WXOMCRNSXYXWLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=C3C=CC=C(C3=NN2)F |
Computed by PubChem (NCBI)