CAS 1809176-30-4 is the registry number for (E)-1-(5-Amino-1,1,1-trifluoropentan-2-ylidene)-2-phenylhydrazine hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
N-[(E)-(5-amino-1,1,1-trifluoropentan-2-ylidene)amino]aniline;hydrochloride (CAS 1809176-30-4) is a chemical compound with the molecular formula C11H15ClF3N3 and a molecular weight of 281.70 g/mol. IUPAC name: N-[(E)-(5-amino-1,1,1-trifluoropentan-2-ylidene)amino]aniline;hydrochloride. InChIKey: BRXWZVVAAZXBLN-LZMXEPDESA-N.
| Molecular formula | C11H15ClF3N3 |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | N-[(E)-(5-amino-1,1,1-trifluoropentan-2-ylidene)amino]aniline;hydrochloride |
| InChIKey | BRXWZVVAAZXBLN-LZMXEPDESA-N |
| SMILES | C1=CC=C(C=C1)N/N=C(\CCCN)/C(F)(F)F.Cl |
Computed by PubChem (NCBI)