Products 1809221-73-5
CAS 1809221-73-5 is the registry number for 3',5'-Di-O-acetyl-2'-deoxy-5-formylcytidine. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
[(2R,3S,5R)-3-acetyloxy-5-(4-amino-5-formyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (CAS 1809221-73-5) is a chemical compound with the molecular formula C14H17N3O7 and a molecular weight of 339.30 g/mol. IUPAC name: [(2R,3S,5R)-3-acetyloxy-5-(4-amino-5-formyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate. InChIKey: DJFOVGZZEQCONE-QJPTWQEYSA-N.
| Molecular formula | C14H17N3O7 |
|---|---|
| Molecular weight | 339.30 g/mol |
| IUPAC name | [(2R,3S,5R)-3-acetyloxy-5-(4-amino-5-formyl-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| InChIKey | DJFOVGZZEQCONE-QJPTWQEYSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C[C@@H](O1)N2C=C(C(=NC2=O)N)C=O)OC(=O)C |
Computed by PubChem (NCBI)