Products 1809417-27-3

CAS 1809417-27-3 is the registry number for 2-(2'-Methoxy-(1,1'-biphenyl)-4-yl)-1,3-dioxolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-[4-(2-methoxyphenyl)phenyl]-1,3-dioxolane (CAS 1809417-27-3) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-[4-(2-methoxyphenyl)phenyl]-1,3-dioxolane. InChIKey: OGMORWLUUYNSEU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O3
Molecular weight256.30 g/mol
IUPAC name2-[4-(2-methoxyphenyl)phenyl]-1,3-dioxolane
InChIKeyOGMORWLUUYNSEU-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1C2=CC=C(C=C2)C3OCCO3

Computed by PubChem (NCBI)