Products 1809420-71-0
CAS 1809420-71-0 appears in our catalog under these names: Resomelagon, Resomelagon, 98.79%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5 mg, 10 mg, 25 mg, 50 mg, 100 mg.
2-[(E)-[(E)-3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]amino]guanidine (CAS 1809420-71-0) is a chemical compound with the molecular formula C14H14N6O2 and a molecular weight of 298.30 g/mol. IUPAC name: 2-[(E)-[(E)-3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]amino]guanidine. InChIKey: ZSDGHWLLLGYAJV-AHEHSYJASA-N.
| Molecular formula | C14H14N6O2 |
|---|---|
| Molecular weight | 298.30 g/mol |
| IUPAC name | 2-[(E)-[(E)-3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]amino]guanidine |
| InChIKey | ZSDGHWLLLGYAJV-AHEHSYJASA-N |
| SMILES | C1=CC=C(C(=C1)N2C=CC=C2/C=C/C=N/N=C(N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)