CAS 1809464-27-4 appears in our catalog under these names: 2-(4?-Chloro-2,3,4,5-tetrahydro-(1,1?-biphenyl)-4-yl)-3-hydroxynaphthalene-1,4-dione, 2-(4'-Chloro-2,3,4,5-tetrahydro-[1,1'-biphenyl]-4-yl)-3-hydroxynaphthalene-1,4-dione, 95%, Atovaquone EP Impurity C (Didehydro Atovaquone), Atovaquone EP Impurity C, Atovaquone Impurity 3(Atovaquone EP Impurity C). Offered by: Biosynth, Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: 25mg, 10mg, 50mg, on request, 100mg, 200mg, 2,5mg.
3-[4-(4-chlorophenyl)cyclohex-3-en-1-yl]-4-hydroxynaphthalene-1,2-dione (CAS 1809464-27-4) is a chemical compound with the molecular formula C22H17ClO3 and a molecular weight of 364.8 g/mol. IUPAC name: 3-[4-(4-chlorophenyl)cyclohex-3-en-1-yl]-4-hydroxynaphthalene-1,2-dione. InChIKey: HZBPGPKKLODCKG-UHFFFAOYSA-N.
| Molecular formula | C22H17ClO3 |
|---|---|
| Molecular weight | 364.8 g/mol |
| IUPAC name | 3-[4-(4-chlorophenyl)cyclohex-3-en-1-yl]-4-hydroxynaphthalene-1,2-dione |
| InChIKey | HZBPGPKKLODCKG-UHFFFAOYSA-N |
| SMILES | C1CC(=CCC1C2=C(C3=CC=CC=C3C(=O)C2=O)O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)