Products 180975-57-9
CAS 180975-57-9 is the registry number for tert-Butyl (1S,3R)-5-azaspiro[2.4]heptan-1-ylcarbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S,3R)-5-azaspiro[2.4]heptan-2-yl]carbamate (CAS 180975-57-9) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-[(2S,3R)-5-azaspiro[2.4]heptan-2-yl]carbamate. InChIKey: MWTHZUMWDMOWQO-GZMMTYOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-[(2S,3R)-5-azaspiro[2.4]heptan-2-yl]carbamate |
| InChIKey | MWTHZUMWDMOWQO-GZMMTYOYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@]12CCNC2 |
Computed by PubChem (NCBI)