CAS 1809889-91-5 is the registry number for tert-Butyl 2-Bromo-2-methylpropanoate-D6. Offered by: TRC. Available pack sizes: 100mg.
Tert-butyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate (CAS 1809889-91-5) is a chemical compound with the molecular formula C8H15BrO2 and a molecular weight of 229.14 g/mol. IUPAC name: tert-butyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate. InChIKey: IGVNJALYNQVQIT-RKAHMFOGSA-N.
| Molecular formula | C8H15BrO2 |
|---|---|
| Molecular weight | 229.14 g/mol |
| IUPAC name | tert-butyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate |
| InChIKey | IGVNJALYNQVQIT-RKAHMFOGSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)OC(C)(C)C)(C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)