CAS 1810070-29-1 appears in our catalog under these names: N-Methyl-3-phenylbicyclo[1.1.1]pentan-1-amine hydrobromide, 95%, N-Methyl-3-phenylbicyclo(1.1.1)pentan-1-amine hydrobromide, 97%, N-Methyl-3-phenylbicyclo[1.1.1]pentan-1-amine hydrobromide, 97%, 97%, N-Methyl-3-phenylbicyclo[1.1.1]pentan-1-amine hydrobromide, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
N-methyl-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrobromide (CAS 1810070-29-1) is a chemical compound with the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. IUPAC name: N-methyl-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrobromide. InChIKey: BJBHAONGELCUOV-UHFFFAOYSA-N.
| Molecular formula | C12H16BrN |
|---|---|
| Molecular weight | 254.17 g/mol |
| IUPAC name | N-methyl-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrobromide |
| InChIKey | BJBHAONGELCUOV-UHFFFAOYSA-N |
| SMILES | CNC12CC(C1)(C2)C3=CC=CC=C3.Br |
Computed by PubChem (NCBI)