CAS 1810074-73-7 appears in our catalog under these names: (S)-1-(4-Bromophenyl)-n-methylethanamine hydrochloride, 95%, (S)–1–(4–Bromophenyl)–N–methylethanamine hydrochloride, (1S)-1-(4-Bromophenyl)-N-methylethanamine hydrochloride, (S)-1-(4-Bromophenyl)-N-methylethanamine hydrochloride 95%, (S)-1-(4-Bromophenyl)-N-methylethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,5g, 50mg.
(1S)-1-(4-bromophenyl)-N-methylethanamine;hydrochloride (CAS 1810074-73-7) is a chemical compound with the molecular formula C9H13BrClN and a molecular weight of 250.56 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)-N-methylethanamine;hydrochloride. InChIKey: VAXYPWCMBWZLQT-FJXQXJEOSA-N.
| Molecular formula | C9H13BrClN |
|---|---|
| Molecular weight | 250.56 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)-N-methylethanamine;hydrochloride |
| InChIKey | VAXYPWCMBWZLQT-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Br)NC.Cl |
Computed by PubChem (NCBI)