CAS 1810074-78-2 appears in our catalog under these names: (S)-N-Methyl-n-(pyrrolidin-3-yl)methanesulfonamide hydrochloride, 95%, (S)-N-Methyl-N-(pyrrolidin-3-yl)methanesulfonamide hydrochloride, 97%, (S)-N-Methyl-N-(pyrrolidin-3-yl)methanesulfonamide hydrochloride, 97%, 97%, N-METHYL-N-[(3S)-PYRROLIDIN-3-YL]METHANESULFONAMIDE HCL, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg, 25g.
N-methyl-N-[(3S)-pyrrolidin-3-yl]methanesulfonamide;hydrochloride (CAS 1810074-78-2) is a chemical compound with the molecular formula C6H15ClN2O2S and a molecular weight of 214.71 g/mol. IUPAC name: N-methyl-N-[(3S)-pyrrolidin-3-yl]methanesulfonamide;hydrochloride. InChIKey: YQECDOZPXSNTCY-RGMNGODLSA-N.
| Molecular formula | C6H15ClN2O2S |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | N-methyl-N-[(3S)-pyrrolidin-3-yl]methanesulfonamide;hydrochloride |
| InChIKey | YQECDOZPXSNTCY-RGMNGODLSA-N |
| SMILES | CN([C@H]1CCNC1)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)